C15H15ClFN3O3S2 — CID 90241658
ethyl 2-[[2-[(6-chloro-3-fluoropyridine-2-carbonyl)amino]-1,3-thiazol-5-yl]sulfanyl]-2-methylpropanoate (PubChem CID 90241658) has the molecular formula C15H15ClFN3O3S2 and a molecular weight of 403.89 g/mol. Its IUPAC name is ethyl 2-[[2-[(6-chloro-3-fluoropyridine-2-carbonyl)amino]-1,3-thiazol-5-yl]sulfanyl]-2-methylpropanoate.
| Compound Name | ethyl 2-[[2-[(6-chloro-3-fluoropyridine-2-carbonyl)amino]-1,3-thiazol-5-yl]sulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 90241658 |
| Molecular Formula | C15H15ClFN3O3S2 |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | ethyl 2-[[2-[(6-chloro-3-fluoropyridine-2-carbonyl)amino]-1,3-thiazol-5-yl]sulfanyl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Sc1cnc(NC(=O)c2nc(Cl)ccc2F)s1 |
| InChI | InChI=1S/C15H15ClFN3O3S2/c1-4-23-13(22)15(2,3)25-10-7-18-14(24-10)20-12(21)11-8(17)5-6-9(16)19-11/h5-7H,4H2,1-3H3,(H,18,20,21) |
| InChIKey | ATHYSNIMBDBKAX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|