C22H31N3O4 — CID 90241745
tert-butyl (3R,9aS)-3-(3-methyl-1-oxo-3,4-dihydroisochromen-6-yl)-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine-2-carboxylate (PubChem CID 90241745) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is tert-butyl (3R,9aS)-3-(3-methyl-1-oxo-3,4-dihydroisochromen-6-yl)-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine-2-carboxylate.
| Compound Name | tert-butyl (3R,9aS)-3-(3-methyl-1-oxo-3,4-dihydroisochromen-6-yl)-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 90241745 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | tert-butyl (3R,9aS)-3-(3-methyl-1-oxo-3,4-dihydroisochromen-6-yl)-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazine-2-carboxylate |
| SMILES | CC1Cc2cc([C@@H]3CN4CCNC[C@H]4CN3C(=O)OC(C)(C)C)ccc2C(=O)O1 |
| InChI | InChI=1S/C22H31N3O4/c1-14-9-16-10-15(5-6-18(16)20(26)28-14)19-13-24-8-7-23-11-17(24)12-25(19)21(27)29-22(2,3)4/h5-6,10,14,17,19,23H,7-9,11-13H2,1-4H3/t14?,17-,19-/m0/s1 |
| InChIKey | DNFLQEFYMSDCPD-WGAGKFISSA-N |
| XLogP | 2.35 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |