C9H7N3OS2 — CID 90242583
3-(1,3-thiazol-5-ylsulfanyl)pyridine-2-carboxamide (PubChem CID 90242583) has the molecular formula C9H7N3OS2 and a molecular weight of 237.31 g/mol. Its IUPAC name is 3-(1,3-thiazol-5-ylsulfanyl)pyridine-2-carboxamide.
| Compound Name | 3-(1,3-thiazol-5-ylsulfanyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90242583 |
| Molecular Formula | C9H7N3OS2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 3-(1,3-thiazol-5-ylsulfanyl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ncccc1Sc1cncs1 |
| InChI | InChI=1S/C9H7N3OS2/c10-9(13)8-6(2-1-3-12-8)15-7-4-11-5-14-7/h1-5H,(H2,10,13) |
| InChIKey | OKMLOJFCYPVQJZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |