C12H14N4O2 — CID 90242922
(7S)-11-methoxy-13-methyl-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),8,11,13-tetraen-2-one (PubChem CID 90242922) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is (7S)-11-methoxy-13-methyl-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),8,11,13-tetraen-2-one.
| Compound Name | (7S)-11-methoxy-13-methyl-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),8,11,13-tetraen-2-one |
|---|---|
| PubChem CID | 90242922 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (7S)-11-methoxy-13-methyl-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),8,11,13-tetraen-2-one |
| SMILES | COc1nc(C)nc2c1N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C12H14N4O2/c1-7-14-10-9(11(15-7)18-2)13-6-8-4-3-5-16(8)12(10)17/h6,8H,3-5H2,1-2H3/t8-/m0/s1 |
| InChIKey | PLIBJYHSFAXDPE-QMMMGPOBSA-N |
| XLogP | 1.11 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |