C12H14N4O3 — CID 10611486
(7S)-11,13-dimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),8,11,13-tetraen-2-one (PubChem CID 10611486) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is (7S)-11,13-dimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),8,11,13-tetraen-2-one.
| Compound Name | (7S)-11,13-dimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),8,11,13-tetraen-2-one |
|---|---|
| PubChem CID | 10611486 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (7S)-11,13-dimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),8,11,13-tetraen-2-one |
| SMILES | COc1nc(OC)c2c(n1)C(=O)N1CCC[C@H]1C=N2 |
| InChI | InChI=1S/C12H14N4O3/c1-18-10-8-9(14-12(15-10)19-2)11(17)16-5-3-4-7(16)6-13-8/h6-7H,3-5H2,1-2H3/t7-/m0/s1 |
| InChIKey | IYEFXQDSCUBINM-ZETCQYMHSA-N |
| XLogP | 0.81 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |