C22H30N4O4S2 — CID 90242993
5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3-thia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione (PubChem CID 90242993) has the molecular formula C22H30N4O4S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is 5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3-thia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione.
| Compound Name | 5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3-thia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
|---|---|
| PubChem CID | 90242993 |
| Molecular Formula | C22H30N4O4S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3-thia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
| SMILES | CC(C)C1NC(=O)C2(C)CSC(=N2)C2=CCC(=N2)CNC(=O)CC(/C=C/CCS)OC1=O |
| InChI | InChI=1S/C22H30N4O4S2/c1-13(2)18-20(28)30-15(6-4-5-9-31)10-17(27)23-11-14-7-8-16(24-14)19-26-22(3,12-32-19)21(29)25-18/h4,6,8,13,15,18,31H,5,7,9-12H2,1-3H3,(H,23,27)(H,25,29)/b6-4+ |
| InChIKey | GIUGZEZJPTXZLC-GQCTYLIASA-N |
| XLogP | 2.07 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|