C20H24N3O2S2+ — CID 9024323
6-[[(S)-(4-butylphenyl)-thiophen-2-ylmethyl]amino]pyridin-1-ium-3-sulfonamide (PubChem CID 9024323) has the molecular formula C20H24N3O2S2+ and a molecular weight of 402.57 g/mol. Its IUPAC name is 6-[[(S)-(4-butylphenyl)-thiophen-2-ylmethyl]amino]pyridin-1-ium-3-sulfonamide.
| Compound Name | 6-[[(S)-(4-butylphenyl)-thiophen-2-ylmethyl]amino]pyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 9024323 |
| Molecular Formula | C20H24N3O2S2+ |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 6-[[(S)-(4-butylphenyl)-thiophen-2-ylmethyl]amino]pyridin-1-ium-3-sulfonamide |
| SMILES | CCCCc1ccc([C@H](Nc2ccc(S(N)(=O)=O)c[nH+]2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H23N3O2S2/c1-2-3-5-15-7-9-16(10-8-15)20(18-6-4-13-26-18)23-19-12-11-17(14-22-19)27(21,24)25/h4,6-14,20H,2-3,5H2,1H3,(H,22,23)(H2,21,24,25)/p+1/t20-/m0/s1 |
| InChIKey | HSICGFBXTPHNNN-FQEVSTJZSA-O |
| XLogP | 3.75 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |