C19H40N2+2 — CID 90245498
1-ethyl-1-[3-(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propyl]-3,4-dimethylpyrrolidin-1-ium (PubChem CID 90245498) has the molecular formula C19H40N2+2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 1-ethyl-1-[3-(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propyl]-3,4-dimethylpyrrolidin-1-ium.
| Compound Name | 1-ethyl-1-[3-(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propyl]-3,4-dimethylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 90245498 |
| Molecular Formula | C19H40N2+2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | 1-ethyl-1-[3-(1-ethyl-3,4-dimethylpyrrolidin-1-ium-1-yl)propyl]-3,4-dimethylpyrrolidin-1-ium |
| SMILES | CC[N+]1(CCC[N+]2(CC)CC(C)C(C)C2)CC(C)C(C)C1 |
| InChI | InChI=1S/C19H40N2/c1-7-20(12-16(3)17(4)13-20)10-9-11-21(8-2)14-18(5)19(6)15-21/h16-19H,7-15H2,1-6H3/q+2 |
| InChIKey | USCBFUFMPNLYHR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|