About N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide
N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide (PubChem CID 90248281) has the molecular formula C15H31N3O
and a molecular weight of 269.43 g/mol. Its IUPAC name is N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide.
Molecular Properties
| Compound Name | N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide |
| PubChem CID | 90248281 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide |
| SMILES | CC/C=C\C(C)CN(CC)CC(O)C/N=C/NCC |
| InChI | InChI=1S/C15H31N3O/c1-5-8-9-14(4)11-18(7-3)12-15(19)10-17-13-16-6-2/h8-9,13-15,19H,5-7,10-12H2,1-4H3,(H,16,17)/b9-8- |
| InChIKey | XBBSJZICCOEQJE-HJWRWDBZSA-N |
| XLogP | 1.91 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide?
The IUPAC name of N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide (CID 90248281) is N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide.
What is the SMILES notation for N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide?
The canonical SMILES for N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide is CC/C=C\C(C)CN(CC)CC(O)C/N=C/NCC.
What is the InChIKey of N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide?
The InChIKey is XBBSJZICCOEQJE-HJWRWDBZSA-N. The full InChI is InChI=1S/C15H31N3O/c1-5-8-9-14(4)11-18(7-3)12-15(19)10-17-13-16-6-2/h8-9,13-15,19H,5-7,10-12H2,1-4H3,(H,16,17)/b9-8-.
What are the key properties of N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide?
N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide has a molecular weight of 269.43 g/mol, XLogP of 1.91, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-[3-[ethyl-[(Z)-2-methylhex-3-enyl]amino]-2-hydroxypropyl]methanimidamide is sourced from PubChem (CID 90248281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).