C38H43NO12 — CID 90251263
[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 90251263) has the molecular formula C38H43NO12 and a molecular weight of 705.76 g/mol. Its IUPAC name is [2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 90251263 |
| Molecular Formula | C38H43NO12 |
| Molecular Weight | 705.76 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | [2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCO1)N1CCC2(CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-c1ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc12 |
| InChI | InChI=1S/C38H43NO12/c40-18-29-33(44)35(46)31(42)26(50-29)9-5-20-3-7-22-23-8-4-21(6-10-27-32(43)36(47)34(45)30(19-41)51-27)17-25(23)38(24(22)16-20)11-13-39(14-12-38)37(48)28-2-1-15-49-28/h3-4,7-8,16-17,26-36,40-47H,1-2,11-15,18-19H2/t26-,27-,28+,29-,30-,31-,32-,33-,34-,35-,36-/m1/s1 |
| InChIKey | QTTRBMULVRZNFE-RXGGSRCHSA-N |
| XLogP | -1.86 |
| TPSA | 209.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.76 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|