C15H22O4Si2 — CID 90256258
4,7-bis(trimethylsilyloxy)chromen-2-one (PubChem CID 90256258) has the molecular formula C15H22O4Si2 and a molecular weight of 322.51 g/mol. Its IUPAC name is 4,7-bis(trimethylsilyloxy)chromen-2-one.
| Compound Name | 4,7-bis(trimethylsilyloxy)chromen-2-one |
|---|---|
| PubChem CID | 90256258 |
| Molecular Formula | C15H22O4Si2 |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4,7-bis(trimethylsilyloxy)chromen-2-one |
| SMILES | C[Si](C)(C)Oc1ccc2c(O[Si](C)(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C15H22O4Si2/c1-20(2,3)18-11-7-8-12-13(9-11)17-15(16)10-14(12)19-21(4,5)6/h7-10H,1-6H3 |
| InChIKey | YJYVWOLRBUXAGN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|