C27H42O6Si4 — CID 529518
2-[3,4-bis(trimethylsilyloxy)phenyl]-3,7-bis(trimethylsilyloxy)chromen-4-one (PubChem CID 529518) has the molecular formula C27H42O6Si4 and a molecular weight of 574.97 g/mol. Its IUPAC name is 2-[3,4-bis(trimethylsilyloxy)phenyl]-3,7-bis(trimethylsilyloxy)chromen-4-one.
| Compound Name | 2-[3,4-bis(trimethylsilyloxy)phenyl]-3,7-bis(trimethylsilyloxy)chromen-4-one |
|---|---|
| PubChem CID | 529518 |
| Molecular Formula | C27H42O6Si4 |
| Molecular Weight | 574.97 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 2-[3,4-bis(trimethylsilyloxy)phenyl]-3,7-bis(trimethylsilyloxy)chromen-4-one |
| SMILES | C[Si](C)(C)Oc1ccc2c(=O)c(O[Si](C)(C)C)c(-c3ccc(O[Si](C)(C)C)c(O[Si](C)(C)C)c3)oc2c1 |
| InChI | InChI=1S/C27H42O6Si4/c1-34(2,3)30-20-14-15-21-23(18-20)29-26(27(25(21)28)33-37(10,11)12)19-13-16-22(31-35(4,5)6)24(17-19)32-36(7,8)9/h13-18H,1-12H3 |
| InChIKey | LZIQFUABPZZTFQ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.97 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|