C29H35NO4 — CID 90259092
(1R,9R,10S,12S)-6-(cyclopropylmethyl)-10-hydroxy-12-(2-hydroxyethyl)-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one (PubChem CID 90259092) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is (1R,9R,10S,12S)-6-(cyclopropylmethyl)-10-hydroxy-12-(2-hydroxyethyl)-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one.
| Compound Name | (1R,9R,10S,12S)-6-(cyclopropylmethyl)-10-hydroxy-12-(2-hydroxyethyl)-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one |
|---|---|
| PubChem CID | 90259092 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | (1R,9R,10S,12S)-6-(cyclopropylmethyl)-10-hydroxy-12-(2-hydroxyethyl)-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one |
| SMILES | O=C1C[C@]23CCN[C@H](Cc4c(CC5CC5)cc(OCc5ccccc5)cc42)[C@]3(O)C[C@@H]1CCO |
| InChI | InChI=1S/C29H35NO4/c31-11-8-21-16-29(33)27-15-24-22(12-19-6-7-19)13-23(34-18-20-4-2-1-3-5-20)14-25(24)28(29,9-10-30-27)17-26(21)32/h1-5,13-14,19,21,27,30-31,33H,6-12,15-18H2/t21-,27+,28+,29+/m0/s1 |
| InChIKey | XVGUUKMXYUESSC-XOBBBKNESA-N |
| XLogP | 3.47 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |