C24H25NO3 — CID 143809404
(1S,9R,10S,14S)-18-methylidene-4-phenylmethoxy-13-oxa-17-azapentacyclo[7.5.3.112,14.01,10.02,7]octadeca-2(7),3,5-trien-10-ol (PubChem CID 143809404) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1S,9R,10S,14S)-18-methylidene-4-phenylmethoxy-13-oxa-17-azapentacyclo[7.5.3.112,14.01,10.02,7]octadeca-2(7),3,5-trien-10-ol.
| Compound Name | (1S,9R,10S,14S)-18-methylidene-4-phenylmethoxy-13-oxa-17-azapentacyclo[7.5.3.112,14.01,10.02,7]octadeca-2(7),3,5-trien-10-ol |
|---|---|
| PubChem CID | 143809404 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (1S,9R,10S,14S)-18-methylidene-4-phenylmethoxy-13-oxa-17-azapentacyclo[7.5.3.112,14.01,10.02,7]octadeca-2(7),3,5-trien-10-ol |
| SMILES | C=C1C2C[C@@]3(O)[C@H]4Cc5ccc(OCc6ccccc6)cc5[C@@]3(CCN4)[C@H]1O2 |
| InChI | InChI=1S/C24H25NO3/c1-15-20-13-24(26)21-11-17-7-8-18(27-14-16-5-3-2-4-6-16)12-19(17)23(24,9-10-25-21)22(15)28-20/h2-8,12,20-22,25-26H,1,9-11,13-14H2/t20?,21-,22+,23+,24-/m1/s1 |
| InChIKey | ZSQJRPMPNZKKND-AXMVFTSKSA-N |
| XLogP | 2.88 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|