C50H99N2O12+ — CID 90259523
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[(E)-octadec-9-enoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 3-(4-butyl-4-methylpiperazin-4-ium-1-yl)propanoate (PubChem CID 90259523) has the molecular formula C50H99N2O12+ and a molecular weight of 920.34 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[(E)-octadec-9-enoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 3-(4-butyl-4-methylpiperazin-4-ium-1-yl)propanoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[(E)-octadec-9-enoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 3-(4-butyl-4-methylpiperazin-4-ium-1-yl)propanoate |
|---|---|
| PubChem CID | 90259523 |
| Molecular Formula | C50H99N2O12+ |
| Molecular Weight | 920.34 g/mol |
| Exact Mass | 919.72 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[(E)-octadec-9-enoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 3-(4-butyl-4-methylpiperazin-4-ium-1-yl)propanoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC(=O)CCN1CC[N+](C)(CCCC)CC1 |
| InChI | InChI=1S/C50H99N2O12/c1-4-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-29-54-30-31-55-32-33-56-34-35-57-36-37-58-38-39-59-40-41-60-42-43-61-44-45-62-46-47-63-48-49-64-50(53)22-23-51-24-27-52(3,28-25-51)26-7-5-2/h13-14H,4-12,15-49H2,1-3H3/q+1/b14-13+ |
| InChIKey | USJJPOOFWNXDNZ-BUHFOSPRSA-N |
| XLogP | 7.69 |
| TPSA | 121.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.34 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|