C34H67BrN2O4 — CID 90259783
2-[2-[(Z)-octadec-9-enoxy]ethoxy]ethyl 3-(4-butyl-4-methylpiperazin-4-ium-1-yl)propanoate bromide (PubChem CID 90259783) has the molecular formula C34H67BrN2O4 and a molecular weight of 647.82 g/mol. Its IUPAC name is 2-[2-[(Z)-octadec-9-enoxy]ethoxy]ethyl 3-(4-butyl-4-methylpiperazin-4-ium-1-yl)propanoate bromide.
| Compound Name | 2-[2-[(Z)-octadec-9-enoxy]ethoxy]ethyl 3-(4-butyl-4-methylpiperazin-4-ium-1-yl)propanoate bromide |
|---|---|
| PubChem CID | 90259783 |
| Molecular Formula | C34H67BrN2O4 |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 646.43 |
| IUPAC Name | 2-[2-[(Z)-octadec-9-enoxy]ethoxy]ethyl 3-(4-butyl-4-methylpiperazin-4-ium-1-yl)propanoate bromide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCCOCCOC(=O)CCN1CC[N+](C)(CCCC)CC1.[Br-] |
| InChI | InChI=1S/C34H67N2O4.BrH/c1-4-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-29-38-30-31-39-32-33-40-34(37)22-23-35-24-27-36(3,28-25-35)26-7-5-2;/h13-14H,4-12,15-33H2,1-3H3;1H/q+1;/p-1/b14-13-; |
| InChIKey | OFXUMKKXAWVIRP-HPWRNOGASA-M |
| XLogP | 4.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|