C50H46N2OSi2 — CID 90263126
4-N,20-N-diphenyl-4-N,20-N-bis(4-trimethylsilylphenyl)-12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-4,20-diamine (PubChem CID 90263126) has the molecular formula C50H46N2OSi2 and a molecular weight of 747.10 g/mol. Its IUPAC name is 4-N,20-N-diphenyl-4-N,20-N-bis(4-trimethylsilylphenyl)-12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-4,20-diamine.
| Compound Name | 4-N,20-N-diphenyl-4-N,20-N-bis(4-trimethylsilylphenyl)-12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-4,20-diamine |
|---|---|
| PubChem CID | 90263126 |
| Molecular Formula | C50H46N2OSi2 |
| Molecular Weight | 747.10 g/mol |
| Exact Mass | 746.31 |
| IUPAC Name | 4-N,20-N-diphenyl-4-N,20-N-bis(4-trimethylsilylphenyl)-12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-4,20-diamine |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccccc2)c2cc3c4cc(N(c5ccccc5)c5ccc([Si](C)(C)C)cc5)c5ccccc5c4oc3c3ccccc23)cc1 |
| InChI | InChI=1S/C50H46N2OSi2/c1-54(2,3)39-29-25-37(26-30-39)51(35-17-9-7-10-18-35)47-33-45-46-34-48(52(36-19-11-8-12-20-36)38-27-31-40(32-28-38)55(4,5)6)42-22-14-16-24-44(42)50(46)53-49(45)43-23-15-13-21-41(43)47/h7-34H,1-6H3 |
| InChIKey | HNPDFVMRUDPSHC-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.10 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|