C54H56N2Si — CID 58098957
6-N,12-N-bis(3,5-diethylphenyl)-6-N-(4-methylphenyl)-12-N-(4-trimethylsilylphenyl)chrysene-6,12-diamine (PubChem CID 58098957) has the molecular formula C54H56N2Si and a molecular weight of 761.14 g/mol. Its IUPAC name is 6-N,12-N-bis(3,5-diethylphenyl)-6-N-(4-methylphenyl)-12-N-(4-trimethylsilylphenyl)chrysene-6,12-diamine.
| Compound Name | 6-N,12-N-bis(3,5-diethylphenyl)-6-N-(4-methylphenyl)-12-N-(4-trimethylsilylphenyl)chrysene-6,12-diamine |
|---|---|
| PubChem CID | 58098957 |
| Molecular Formula | C54H56N2Si |
| Molecular Weight | 761.14 g/mol |
| Exact Mass | 760.42 |
| IUPAC Name | 6-N,12-N-bis(3,5-diethylphenyl)-6-N-(4-methylphenyl)-12-N-(4-trimethylsilylphenyl)chrysene-6,12-diamine |
| SMILES | CCc1cc(CC)cc(N(c2ccc(C)cc2)c2cc3c4ccccc4c(N(c4ccc([Si](C)(C)C)cc4)c4cc(CC)cc(CC)c4)cc3c3ccccc23)c1 |
| InChI | InChI=1S/C54H56N2Si/c1-9-38-29-39(10-2)32-44(31-38)55(42-23-21-37(5)22-24-42)53-35-51-48-18-14-16-20-50(48)54(36-52(51)47-17-13-15-19-49(47)53)56(43-25-27-46(28-26-43)57(6,7)8)45-33-40(11-3)30-41(12-4)34-45/h13-36H,9-12H2,1-8H3 |
| InChIKey | LVOUCBKESOEEEI-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.14 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|