C48H44N2O2Si — CID 58098960
6-N,12-N-bis(4-methoxyphenyl)-6-N-(4-methylphenyl)-12-N-(4-trimethylsilylphenyl)chrysene-6,12-diamine (PubChem CID 58098960) has the molecular formula C48H44N2O2Si and a molecular weight of 708.98 g/mol. Its IUPAC name is 6-N,12-N-bis(4-methoxyphenyl)-6-N-(4-methylphenyl)-12-N-(4-trimethylsilylphenyl)chrysene-6,12-diamine.
| Compound Name | 6-N,12-N-bis(4-methoxyphenyl)-6-N-(4-methylphenyl)-12-N-(4-trimethylsilylphenyl)chrysene-6,12-diamine |
|---|---|
| PubChem CID | 58098960 |
| Molecular Formula | C48H44N2O2Si |
| Molecular Weight | 708.98 g/mol |
| Exact Mass | 708.32 |
| IUPAC Name | 6-N,12-N-bis(4-methoxyphenyl)-6-N-(4-methylphenyl)-12-N-(4-trimethylsilylphenyl)chrysene-6,12-diamine |
| SMILES | COc1ccc(N(c2ccc(C)cc2)c2cc3c4ccccc4c(N(c4ccc(OC)cc4)c4ccc([Si](C)(C)C)cc4)cc3c3ccccc23)cc1 |
| InChI | InChI=1S/C48H44N2O2Si/c1-33-15-17-34(18-16-33)49(35-19-25-38(51-2)26-20-35)47-31-45-42-12-8-10-14-44(42)48(32-46(45)41-11-7-9-13-43(41)47)50(36-21-27-39(52-3)28-22-36)37-23-29-40(30-24-37)53(4,5)6/h7-32H,1-6H3 |
| InChIKey | JVZTYDPPHIQVBU-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.98 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|