C74H66N4O6 — CID 59308978
4,9-dimethoxy-1-N,3-N,6-N,8-N-tetrakis(4-methoxyphenyl)-1-N,3-N,6-N,8-N-tetrakis(4-methylphenyl)pyrene-1,3,6,8-tetramine (PubChem CID 59308978) has the molecular formula C74H66N4O6 and a molecular weight of 1107.36 g/mol. Its IUPAC name is 4,9-dimethoxy-1-N,3-N,6-N,8-N-tetrakis(4-methoxyphenyl)-1-N,3-N,6-N,8-N-tetrakis(4-methylphenyl)pyrene-1,3,6,8-tetramine.
| Compound Name | 4,9-dimethoxy-1-N,3-N,6-N,8-N-tetrakis(4-methoxyphenyl)-1-N,3-N,6-N,8-N-tetrakis(4-methylphenyl)pyrene-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 59308978 |
| Molecular Formula | C74H66N4O6 |
| Molecular Weight | 1107.36 g/mol |
| Exact Mass | 1106.50 |
| IUPAC Name | 4,9-dimethoxy-1-N,3-N,6-N,8-N-tetrakis(4-methoxyphenyl)-1-N,3-N,6-N,8-N-tetrakis(4-methylphenyl)pyrene-1,3,6,8-tetramine |
| SMILES | COc1ccc(N(c2ccc(C)cc2)c2cc(N(c3ccc(C)cc3)c3ccc(OC)cc3)c3c(OC)cc4c(N(c5ccc(C)cc5)c5ccc(OC)cc5)cc(N(c5ccc(C)cc5)c5ccc(OC)cc5)c5c(OC)cc2c3c45)cc1 |
| InChI | InChI=1S/C74H66N4O6/c1-47-11-19-51(20-12-47)75(55-27-35-59(79-5)36-28-55)65-45-67(77(53-23-15-49(3)16-24-53)57-31-39-61(81-7)40-32-57)73-70(84-10)44-64-66(76(52-21-13-48(2)14-22-52)56-29-37-60(80-6)38-30-56)46-68(74-69(83-9)43-63(65)71(73)72(64)74)78(54-25-17-50(4)18-26-54)58-33-41-62(82-8)42-34-58/h11-46H,1-10H3 |
| InChIKey | MNVAFRDSFANUND-UHFFFAOYSA-N |
| XLogP | 19.75 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.36 |
| LogP ≤ 5 | 19.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|