C48H49N3Si2 — CID 174084078
5-N,9-N-bis(4-methylphenyl)-5-N,9-N-bis(4-trimethylsilylphenyl)-7H-benzo[c]carbazole-5,9-diamine (PubChem CID 174084078) has the molecular formula C48H49N3Si2 and a molecular weight of 724.11 g/mol. Its IUPAC name is 5-N,9-N-bis(4-methylphenyl)-5-N,9-N-bis(4-trimethylsilylphenyl)-7H-benzo[c]carbazole-5,9-diamine.
| Compound Name | 5-N,9-N-bis(4-methylphenyl)-5-N,9-N-bis(4-trimethylsilylphenyl)-7H-benzo[c]carbazole-5,9-diamine |
|---|---|
| PubChem CID | 174084078 |
| Molecular Formula | C48H49N3Si2 |
| Molecular Weight | 724.11 g/mol |
| Exact Mass | 723.35 |
| IUPAC Name | 5-N,9-N-bis(4-methylphenyl)-5-N,9-N-bis(4-trimethylsilylphenyl)-7H-benzo[c]carbazole-5,9-diamine |
| SMILES | Cc1ccc(N(c2ccc([Si](C)(C)C)cc2)c2ccc3c(c2)[nH]c2cc(N(c4ccc(C)cc4)c4ccc([Si](C)(C)C)cc4)c4ccccc4c23)cc1 |
| InChI | InChI=1S/C48H49N3Si2/c1-33-13-17-35(18-14-33)50(36-21-26-40(27-22-36)52(3,4)5)39-25-30-44-45(31-39)49-46-32-47(42-11-9-10-12-43(42)48(44)46)51(37-19-15-34(2)16-20-37)38-23-28-41(29-24-38)53(6,7)8/h9-32,49H,1-8H3 |
| InChIKey | JMJYLCBOUOTBJQ-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.11 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|