C33H36BFN2O6 — CID 90271179
[1'-[3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-5-yl]methylcarbamic acid (PubChem CID 90271179) has the molecular formula C33H36BFN2O6 and a molecular weight of 586.47 g/mol. Its IUPAC name is [1'-[3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-5-yl]methylcarbamic acid.
| Compound Name | [1'-[3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-5-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 90271179 |
| Molecular Formula | C33H36BFN2O6 |
| Molecular Weight | 586.47 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | [1'-[3-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-5-yl]methylcarbamic acid |
| SMILES | CC1(C)OB(c2cc(F)cc(-c3cccc(C(=O)N4CCC5(CC4)COc4ccc(CNC(=O)O)cc45)c3)c2)OC1(C)C |
| InChI | InChI=1S/C33H36BFN2O6/c1-31(2)32(3,4)43-34(42-31)25-16-24(17-26(35)18-25)22-6-5-7-23(15-22)29(38)37-12-10-33(11-13-37)20-41-28-9-8-21(14-27(28)33)19-36-30(39)40/h5-9,14-18,36H,10-13,19-20H2,1-4H3,(H,39,40) |
| InChIKey | CFCGJLZTGQOKQD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|