C27H29BN2O4 — CID 90368347
[3-[3-[5-(methylaminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl]phenyl]phenyl]boronic acid (PubChem CID 90368347) has the molecular formula C27H29BN2O4 and a molecular weight of 456.35 g/mol. Its IUPAC name is [3-[3-[5-(methylaminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl]phenyl]phenyl]boronic acid.
| Compound Name | [3-[3-[5-(methylaminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl]phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 90368347 |
| Molecular Formula | C27H29BN2O4 |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | [3-[3-[5-(methylaminomethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-carbonyl]phenyl]phenyl]boronic acid |
| SMILES | CNCc1ccc2c(c1)C1(CCN(C(=O)c3cccc(-c4cccc(B(O)O)c4)c3)CC1)CO2 |
| InChI | InChI=1S/C27H29BN2O4/c1-29-17-19-8-9-25-24(14-19)27(18-34-25)10-12-30(13-11-27)26(31)22-6-2-4-20(15-22)21-5-3-7-23(16-21)28(32)33/h2-9,14-16,29,32-33H,10-13,17-18H2,1H3 |
| InChIKey | XEODDTGYPVJLRC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|