C23H26ClNO4 — CID 90273004
methyl 3-[4-(benzylcarbamoyl)cyclohexyl]oxy-5-chloro-2-methylbenzoate (PubChem CID 90273004) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is methyl 3-[4-(benzylcarbamoyl)cyclohexyl]oxy-5-chloro-2-methylbenzoate.
| Compound Name | methyl 3-[4-(benzylcarbamoyl)cyclohexyl]oxy-5-chloro-2-methylbenzoate |
|---|---|
| PubChem CID | 90273004 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | methyl 3-[4-(benzylcarbamoyl)cyclohexyl]oxy-5-chloro-2-methylbenzoate |
| SMILES | COC(=O)c1cc(Cl)cc(OC2CCC(C(=O)NCc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C23H26ClNO4/c1-15-20(23(27)28-2)12-18(24)13-21(15)29-19-10-8-17(9-11-19)22(26)25-14-16-6-4-3-5-7-16/h3-7,12-13,17,19H,8-11,14H2,1-2H3,(H,25,26) |
| InChIKey | RXVSKGQNXCETNE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |