C18H22N4O5S — CID 9027332
4-[methyl-[4-[(Z)-C-methyl-N-(1H-pyrrole-2-carbonylamino)carbonimidoyl]phenyl]sulfonylamino]butanoic acid (PubChem CID 9027332) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is 4-[methyl-[4-[(Z)-C-methyl-N-(1H-pyrrole-2-carbonylamino)carbonimidoyl]phenyl]sulfonylamino]butanoic acid.
| Compound Name | 4-[methyl-[4-[(Z)-C-methyl-N-(1H-pyrrole-2-carbonylamino)carbonimidoyl]phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 9027332 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-[methyl-[4-[(Z)-C-methyl-N-(1H-pyrrole-2-carbonylamino)carbonimidoyl]phenyl]sulfonylamino]butanoic acid |
| SMILES | C/C(=N/NC(=O)c1ccc[nH]1)c1ccc(S(=O)(=O)N(C)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C18H22N4O5S/c1-13(20-21-18(25)16-5-3-11-19-16)14-7-9-15(10-8-14)28(26,27)22(2)12-4-6-17(23)24/h3,5,7-11,19H,4,6,12H2,1-2H3,(H,21,25)(H,23,24)/b20-13- |
| InChIKey | VKAYOXQFFVSYQU-MOSHPQCFSA-N |
| XLogP | 1.65 |
| TPSA | 131.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|