C17H16ClN7O5 — CID 90276808
[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]methyl 2-(2-chloro-4-nitrophenoxy)acetate (PubChem CID 90276808) has the molecular formula C17H16ClN7O5 and a molecular weight of 433.81 g/mol. Its IUPAC name is [1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]methyl 2-(2-chloro-4-nitrophenoxy)acetate.
| Compound Name | [1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]methyl 2-(2-chloro-4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 90276808 |
| Molecular Formula | C17H16ClN7O5 |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | [1-[(4-amino-2-methylpyrimidin-5-yl)methyl]triazol-4-yl]methyl 2-(2-chloro-4-nitrophenoxy)acetate |
| SMILES | Cc1ncc(Cn2cc(COC(=O)COc3ccc([N+](=O)[O-])cc3Cl)nn2)c(N)n1 |
| InChI | InChI=1S/C17H16ClN7O5/c1-10-20-5-11(17(19)21-10)6-24-7-12(22-23-24)8-30-16(26)9-29-15-3-2-13(25(27)28)4-14(15)18/h2-5,7H,6,8-9H2,1H3,(H2,19,20,21) |
| InChIKey | ULAORIFXMFIBAW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|