C8H4N2O2 — CID 90278010
2-[2-(1,3-oxazol-2-yl)ethynyl]-1,3-oxazole (PubChem CID 90278010) has the molecular formula C8H4N2O2 and a molecular weight of 160.13 g/mol. Its IUPAC name is 2-[2-(1,3-oxazol-2-yl)ethynyl]-1,3-oxazole.
| Compound Name | 2-[2-(1,3-oxazol-2-yl)ethynyl]-1,3-oxazole |
|---|---|
| PubChem CID | 90278010 |
| Molecular Formula | C8H4N2O2 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 2-[2-(1,3-oxazol-2-yl)ethynyl]-1,3-oxazole |
| SMILES | C(#Cc1ncco1)c1ncco1 |
| InChI | InChI=1S/C8H4N2O2/c1(7-9-3-5-11-7)2-8-10-4-6-12-8/h3-6H |
| InChIKey | GLTSWGRYOSHOAY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|