C27H36N2O3 — CID 90280414
[(1S,2S,3R,4aS,8aS)-2,5,5,8a-tetramethyl-3-(pyridin-4-ylmethylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone (PubChem CID 90280414) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is [(1S,2S,3R,4aS,8aS)-2,5,5,8a-tetramethyl-3-(pyridin-4-ylmethylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone.
| Compound Name | [(1S,2S,3R,4aS,8aS)-2,5,5,8a-tetramethyl-3-(pyridin-4-ylmethylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 90280414 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | [(1S,2S,3R,4aS,8aS)-2,5,5,8a-tetramethyl-3-(pyridin-4-ylmethylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone |
| SMILES | C[C@@H]1[C@H](NCc2ccncc2)C[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C27H36N2O3/c1-17-22(29-16-18-6-10-28-11-7-18)15-23-26(2,3)8-5-9-27(23,4)24(17)25(32)19-12-20(30)14-21(31)13-19/h6-7,10-14,17,22-24,29-31H,5,8-9,15-16H2,1-4H3/t17-,22-,23+,24-,27+/m1/s1 |
| InChIKey | XGOIENMCXVMVRH-LEYBTYMMSA-N |
| XLogP | 5.32 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |