C22H33N3O3 — CID 90280518
2-[(2R,3S,4S,4aS,8aS)-4-(3,5-dihydroxybenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]guanidine (PubChem CID 90280518) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-[(2R,3S,4S,4aS,8aS)-4-(3,5-dihydroxybenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]guanidine.
| Compound Name | 2-[(2R,3S,4S,4aS,8aS)-4-(3,5-dihydroxybenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]guanidine |
|---|---|
| PubChem CID | 90280518 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 2-[(2R,3S,4S,4aS,8aS)-4-(3,5-dihydroxybenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]guanidine |
| SMILES | C[C@@H]1[C@H](N=C(N)N)C[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C22H33N3O3/c1-12-16(25-20(23)24)11-17-21(2,3)6-5-7-22(17,4)18(12)19(28)13-8-14(26)10-15(27)9-13/h8-10,12,16-18,26-27H,5-7,11H2,1-4H3,(H4,23,24,25)/t12-,16-,17+,18-,22+/m1/s1 |
| InChIKey | UCLQUKNXAJZTGI-JDVRMBDFSA-N |
| XLogP | 3.41 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|