C27H41NO4 — CID 90281596
tert-butyl N-[(4S,4aS,8aS)-4-(3-hydroxy-5-methylbenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]carbamate (PubChem CID 90281596) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is tert-butyl N-[(4S,4aS,8aS)-4-(3-hydroxy-5-methylbenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,4aS,8aS)-4-(3-hydroxy-5-methylbenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 90281596 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | tert-butyl N-[(4S,4aS,8aS)-4-(3-hydroxy-5-methylbenzoyl)-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]carbamate |
| SMILES | Cc1cc(O)cc(C(=O)[C@H]2C(C)C(NC(=O)OC(C)(C)C)C[C@H]3C(C)(C)CCC[C@]23C)c1 |
| InChI | InChI=1S/C27H41NO4/c1-16-12-18(14-19(29)13-16)23(30)22-17(2)20(28-24(31)32-25(3,4)5)15-21-26(6,7)10-9-11-27(21,22)8/h12-14,17,20-22,29H,9-11,15H2,1-8H3,(H,28,31)/t17?,20?,21-,22+,27-/m0/s1 |
| InChIKey | PSXJOTAEHQRBOJ-BNFRNLPXSA-N |
| XLogP | 6.27 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |