C27H35NO6 — CID 90281999
tert-butyl 4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-phenylmethoxycarbonylamino]ethyl]benzoate (PubChem CID 90281999) has the molecular formula C27H35NO6 and a molecular weight of 469.58 g/mol. Its IUPAC name is tert-butyl 4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-phenylmethoxycarbonylamino]ethyl]benzoate.
| Compound Name | tert-butyl 4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-phenylmethoxycarbonylamino]ethyl]benzoate |
|---|---|
| PubChem CID | 90281999 |
| Molecular Formula | C27H35NO6 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | tert-butyl 4-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-phenylmethoxycarbonylamino]ethyl]benzoate |
| SMILES | CC(C)(C)OC(=O)CN(CCc1ccc(C(=O)OC(C)(C)C)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H35NO6/c1-26(2,3)33-23(29)18-28(25(31)32-19-21-10-8-7-9-11-21)17-16-20-12-14-22(15-13-20)24(30)34-27(4,5)6/h7-15H,16-19H2,1-6H3 |
| InChIKey | YIOJLRHLSZLXAX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|