C20H22N4OS — CID 90287266
4-[2-[3-[2-(dimethylamino)ethoxy]thieno[3,4-b]pyrazin-2-yl]ethynyl]-N,N-dimethylaniline (PubChem CID 90287266) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 4-[2-[3-[2-(dimethylamino)ethoxy]thieno[3,4-b]pyrazin-2-yl]ethynyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[3-[2-(dimethylamino)ethoxy]thieno[3,4-b]pyrazin-2-yl]ethynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 90287266 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-[2-[3-[2-(dimethylamino)ethoxy]thieno[3,4-b]pyrazin-2-yl]ethynyl]-N,N-dimethylaniline |
| SMILES | CN(C)CCOc1nc2cscc2nc1C#Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H22N4OS/c1-23(2)11-12-25-20-17(21-18-13-26-14-19(18)22-20)10-7-15-5-8-16(9-6-15)24(3)4/h5-6,8-9,13-14H,11-12H2,1-4H3 |
| InChIKey | QLZRJOFQEUABES-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|