C23H20N4OS — CID 90287394
N,N-dimethyl-4-[2-[3-(2-pyridin-2-ylethoxy)thieno[3,4-b]pyrazin-2-yl]ethynyl]aniline (PubChem CID 90287394) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[3-(2-pyridin-2-ylethoxy)thieno[3,4-b]pyrazin-2-yl]ethynyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-[3-(2-pyridin-2-ylethoxy)thieno[3,4-b]pyrazin-2-yl]ethynyl]aniline |
|---|---|
| PubChem CID | 90287394 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N,N-dimethyl-4-[2-[3-(2-pyridin-2-ylethoxy)thieno[3,4-b]pyrazin-2-yl]ethynyl]aniline |
| SMILES | CN(C)c1ccc(C#Cc2nc3cscc3nc2OCCc2ccccn2)cc1 |
| InChI | InChI=1S/C23H20N4OS/c1-27(2)19-9-6-17(7-10-19)8-11-20-23(26-22-16-29-15-21(22)25-20)28-14-12-18-5-3-4-13-24-18/h3-7,9-10,13,15-16H,12,14H2,1-2H3 |
| InChIKey | OMRPPLQSCJPAJY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|