C23H23N5O2 — CID 71622559
1-[2-[3-[2-[4-(dimethylamino)phenyl]ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxyethyl]pyrrolidin-2-one (PubChem CID 71622559) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-[2-[3-[2-[4-(dimethylamino)phenyl]ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxyethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[3-[2-[4-(dimethylamino)phenyl]ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71622559 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-[2-[3-[2-[4-(dimethylamino)phenyl]ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxyethyl]pyrrolidin-2-one |
| SMILES | CN(C)c1ccc(C#Cc2nc3ncccc3nc2OCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C23H23N5O2/c1-27(2)18-10-7-17(8-11-18)9-12-20-23(26-19-5-3-13-24-22(19)25-20)30-16-15-28-14-4-6-21(28)29/h3,5,7-8,10-11,13H,4,6,14-16H2,1-2H3 |
| InChIKey | RGGGFOADKKAOGA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|