C22H14F3N3OS — CID 90287381
3-(2-pyridin-2-ylethoxy)-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]thieno[3,4-b]pyrazine (PubChem CID 90287381) has the molecular formula C22H14F3N3OS and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-(2-pyridin-2-ylethoxy)-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]thieno[3,4-b]pyrazine.
| Compound Name | 3-(2-pyridin-2-ylethoxy)-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]thieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 90287381 |
| Molecular Formula | C22H14F3N3OS |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 3-(2-pyridin-2-ylethoxy)-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]thieno[3,4-b]pyrazine |
| SMILES | FC(F)(F)c1ccc(C#Cc2nc3cscc3nc2OCCc2ccccn2)cc1 |
| InChI | InChI=1S/C22H14F3N3OS/c23-22(24,25)16-7-4-15(5-8-16)6-9-18-21(28-20-14-30-13-19(20)27-18)29-12-10-17-3-1-2-11-26-17/h1-5,7-8,11,13-14H,10,12H2 |
| InChIKey | GROQNCKPCNFFPB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|