C11H17NS2 — CID 90287547
2,6-bis(1-methylsulfanylethyl)pyridine (PubChem CID 90287547) has the molecular formula C11H17NS2 and a molecular weight of 227.40 g/mol. Its IUPAC name is 2,6-bis(1-methylsulfanylethyl)pyridine.
| Compound Name | 2,6-bis(1-methylsulfanylethyl)pyridine |
|---|---|
| PubChem CID | 90287547 |
| Molecular Formula | C11H17NS2 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2,6-bis(1-methylsulfanylethyl)pyridine |
| SMILES | CSC(C)c1cccc(C(C)SC)n1 |
| InChI | InChI=1S/C11H17NS2/c1-8(13-3)10-6-5-7-11(12-10)9(2)14-4/h5-9H,1-4H3 |
| InChIKey | CWDHBPYUMSHENF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |