C20H21ClN4O2 — CID 90288804
5-(6-chloro-1,5-naphthyridin-3-yl)-1-(3-morpholin-4-ylpropyl)pyridin-2-one (PubChem CID 90288804) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 5-(6-chloro-1,5-naphthyridin-3-yl)-1-(3-morpholin-4-ylpropyl)pyridin-2-one.
| Compound Name | 5-(6-chloro-1,5-naphthyridin-3-yl)-1-(3-morpholin-4-ylpropyl)pyridin-2-one |
|---|---|
| PubChem CID | 90288804 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 5-(6-chloro-1,5-naphthyridin-3-yl)-1-(3-morpholin-4-ylpropyl)pyridin-2-one |
| SMILES | O=c1ccc(-c2cnc3ccc(Cl)nc3c2)cn1CCCN1CCOCC1 |
| InChI | InChI=1S/C20H21ClN4O2/c21-19-4-3-17-18(23-19)12-16(13-22-17)15-2-5-20(26)25(14-15)7-1-6-24-8-10-27-11-9-24/h2-5,12-14H,1,6-11H2 |
| InChIKey | BCXQVBXLDFJMCE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|