C14H14BrN3O2S — CID 9029239
N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 9029239) has the molecular formula C14H14BrN3O2S and a molecular weight of 368.26 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9029239 |
| Molecular Formula | C14H14BrN3O2S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | N-[(Z)-(5-bromo-2-methoxyphenyl)methylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc(Br)cc1/C=N\NC(=O)Cc1nc(C)cs1 |
| InChI | InChI=1S/C14H14BrN3O2S/c1-9-8-21-14(17-9)6-13(19)18-16-7-10-5-11(15)3-4-12(10)20-2/h3-5,7-8H,6H2,1-2H3,(H,18,19)/b16-7- |
| InChIKey | HKHYYWFREXBUAZ-APSNUPSMSA-N |
| XLogP | 2.92 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|