C22H18BrN5O2 — CID 3669972
N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-(2-pyridin-2-ylbenzimidazol-1-yl)acetamide (PubChem CID 3669972) has the molecular formula C22H18BrN5O2 and a molecular weight of 464.32 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-(2-pyridin-2-ylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-(2-pyridin-2-ylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 3669972 |
| Molecular Formula | C22H18BrN5O2 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methylideneamino]-2-(2-pyridin-2-ylbenzimidazol-1-yl)acetamide |
| SMILES | COc1ccc(Br)cc1C=NNC(=O)Cn1c(-c2ccccn2)nc2ccccc21 |
| InChI | InChI=1S/C22H18BrN5O2/c1-30-20-10-9-16(23)12-15(20)13-25-27-21(29)14-28-19-8-3-2-6-17(19)26-22(28)18-7-4-5-11-24-18/h2-13H,14H2,1H3,(H,27,29) |
| InChIKey | MIPPDPJFLAPGII-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|