C28H21N5O4 — CID 41019568
[2-[(E)-[[2-(2-pyridin-2-ylbenzimidazol-1-yl)acetyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 41019568) has the molecular formula C28H21N5O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is [2-[(E)-[[2-(2-pyridin-2-ylbenzimidazol-1-yl)acetyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-[(E)-[[2-(2-pyridin-2-ylbenzimidazol-1-yl)acetyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 41019568 |
| Molecular Formula | C28H21N5O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | [2-[(E)-[[2-(2-pyridin-2-ylbenzimidazol-1-yl)acetyl]hydrazinylidene]methyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(Cn1c(-c2ccccn2)nc2ccccc21)N/N=C/c1ccccc1OC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C28H21N5O4/c34-26(19-33-24-12-3-2-10-22(24)31-28(33)23-11-5-6-16-29-23)32-30-18-20-8-1-4-13-25(20)37-27(35)15-14-21-9-7-17-36-21/h1-18H,19H2,(H,32,34)/b15-14+,30-18+ |
| InChIKey | UWIJKEIBGBDNPS-GCHOTMGESA-N |
| XLogP | 4.46 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|