C28H35N5O7 — CID 90293734
10-O,13-O-ditert-butyl 4-O-methyl 7-oxa-10,13,17,18,21-pentazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2,4,6(22),14(21),15,18-heptaene-4,10,13-tricarboxylate (PubChem CID 90293734) has the molecular formula C28H35N5O7 and a molecular weight of 553.62 g/mol. Its IUPAC name is 10-O,13-O-ditert-butyl 4-O-methyl 7-oxa-10,13,17,18,21-pentazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2,4,6(22),14(21),15,18-heptaene-4,10,13-tricarboxylate.
| Compound Name | 10-O,13-O-ditert-butyl 4-O-methyl 7-oxa-10,13,17,18,21-pentazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2,4,6(22),14(21),15,18-heptaene-4,10,13-tricarboxylate |
|---|---|
| PubChem CID | 90293734 |
| Molecular Formula | C28H35N5O7 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 10-O,13-O-ditert-butyl 4-O-methyl 7-oxa-10,13,17,18,21-pentazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2,4,6(22),14(21),15,18-heptaene-4,10,13-tricarboxylate |
| SMILES | COC(=O)c1cc2cc(c1)-c1cnn3ccc(nc13)N(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCO2 |
| InChI | InChI=1S/C28H35N5O7/c1-27(2,3)39-25(35)31-10-11-32(26(36)40-28(4,5)6)22-8-9-33-23(30-22)21(17-29-33)18-14-19(24(34)37-7)16-20(15-18)38-13-12-31/h8-9,14-17H,10-13H2,1-7H3 |
| InChIKey | TVQTZJGUNKUZIY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 124.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|