C11H13NS — CID 90295857
2-methylidene-3-propan-2-yl-1,3-benzothiazole (PubChem CID 90295857) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-methylidene-3-propan-2-yl-1,3-benzothiazole.
| Compound Name | 2-methylidene-3-propan-2-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 90295857 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2-methylidene-3-propan-2-yl-1,3-benzothiazole |
| SMILES | C=C1Sc2ccccc2N1C(C)C |
| InChI | InChI=1S/C11H13NS/c1-8(2)12-9(3)13-11-7-5-4-6-10(11)12/h4-8H,3H2,1-2H3 |
| InChIKey | YALCSSULIUKBCH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |