About 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine
2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine (PubChem CID 143149796) has the molecular formula C15H16S2
and a molecular weight of 260.43 g/mol. Its IUPAC name is 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine.
Molecular Properties
| Compound Name | 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine |
| PubChem CID | 143149796 |
| Molecular Formula | C15H16S2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine |
| SMILES | C=CC1=C(/C=C\C(C)C)Sc2ccccc2S1 |
| InChI | InChI=1S/C15H16S2/c1-4-12-15(10-9-11(2)3)17-14-8-6-5-7-13(14)16-12/h4-11H,1H2,2-3H3/b10-9- |
| InChIKey | ZYJGPXXCVWNUGB-KTKRTIGZSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine?
The IUPAC name of 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine (CID 143149796) is 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine.
What is the SMILES notation for 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine?
The canonical SMILES for 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine is C=CC1=C(/C=C\C(C)C)Sc2ccccc2S1.
What is the InChIKey of 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine?
The InChIKey is ZYJGPXXCVWNUGB-KTKRTIGZSA-N. The full InChI is InChI=1S/C15H16S2/c1-4-12-15(10-9-11(2)3)17-14-8-6-5-7-13(14)16-12/h4-11H,1H2,2-3H3/b10-9-.
What are the key properties of 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine?
2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine has a molecular weight of 260.43 g/mol, XLogP of 5.49, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3-[(Z)-3-methylbut-1-enyl]-1,4-benzodithiine is sourced from PubChem (CID 143149796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).