C18H22N2S — CID 91465268
2,3-bis(ethenyl)-4-(2-pyrrolidin-1-ylethyl)-1,4-benzothiazine (PubChem CID 91465268) has the molecular formula C18H22N2S and a molecular weight of 298.46 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-(2-pyrrolidin-1-ylethyl)-1,4-benzothiazine.
| Compound Name | 2,3-bis(ethenyl)-4-(2-pyrrolidin-1-ylethyl)-1,4-benzothiazine |
|---|---|
| PubChem CID | 91465268 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2,3-bis(ethenyl)-4-(2-pyrrolidin-1-ylethyl)-1,4-benzothiazine |
| SMILES | C=CC1=C(C=C)N(CCN2CCCC2)c2ccccc2S1 |
| InChI | InChI=1S/C18H22N2S/c1-3-15-17(4-2)21-18-10-6-5-9-16(18)20(15)14-13-19-11-7-8-12-19/h3-6,9-10H,1-2,7-8,11-14H2 |
| InChIKey | RPPQQKKYPQFJIM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |