C16H19NOS2 — CID 169247927
2,3-bis(ethenyl)-4-(3-methylsulfinylpropyl)-1,4-benzothiazine (PubChem CID 169247927) has the molecular formula C16H19NOS2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-(3-methylsulfinylpropyl)-1,4-benzothiazine.
| Compound Name | 2,3-bis(ethenyl)-4-(3-methylsulfinylpropyl)-1,4-benzothiazine |
|---|---|
| PubChem CID | 169247927 |
| Molecular Formula | C16H19NOS2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2,3-bis(ethenyl)-4-(3-methylsulfinylpropyl)-1,4-benzothiazine |
| SMILES | C=CC1=C(C=C)N(CCCS(C)=O)c2ccccc2S1 |
| InChI | InChI=1S/C16H19NOS2/c1-4-13-15(5-2)19-16-10-7-6-9-14(16)17(13)11-8-12-20(3)18/h4-7,9-10H,1-2,8,11-12H2,3H3 |
| InChIKey | UJESHKKQXODPCZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |