C13H11NOS — CID 143481394
2,3-bis(ethenyl)-1,4-benzothiazine-4-carbaldehyde (PubChem CID 143481394) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,4-benzothiazine-4-carbaldehyde.
| Compound Name | 2,3-bis(ethenyl)-1,4-benzothiazine-4-carbaldehyde |
|---|---|
| PubChem CID | 143481394 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2,3-bis(ethenyl)-1,4-benzothiazine-4-carbaldehyde |
| SMILES | C=CC1=C(C=C)N(C=O)c2ccccc2S1 |
| InChI | InChI=1S/C13H11NOS/c1-3-10-12(4-2)16-13-8-6-5-7-11(13)14(10)9-15/h3-9H,1-2H2 |
| InChIKey | GJFMUBCEVSXLLX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|