C16H23NS — CID 142894619
2,3-bis(ethenyl)-4H-1,4-benzothiazine;ethane (PubChem CID 142894619) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4H-1,4-benzothiazine;ethane.
| Compound Name | 2,3-bis(ethenyl)-4H-1,4-benzothiazine;ethane |
|---|---|
| PubChem CID | 142894619 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2,3-bis(ethenyl)-4H-1,4-benzothiazine;ethane |
| SMILES | C=CC1=C(C=C)Sc2ccccc2N1.CC.CC |
| InChI | InChI=1S/C12H11NS.2C2H6/c1-3-9-11(4-2)14-12-8-6-5-7-10(12)13-9;2*1-2/h3-8,13H,1-2H2;2*1-2H3 |
| InChIKey | NVJNWWGMOSINQO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |