About 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen
2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen (PubChem CID 142189141) has the molecular formula C12H13NS
and a molecular weight of 203.31 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen.
Analyze 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen?
The IUPAC name of 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen (CID 142189141) is 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen.
What is the SMILES notation for 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen?
The canonical SMILES for 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen is C=CC1=C(C=C)Sc2ccccc2N1.[H][H].
What is the InChIKey of 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen?
The InChIKey is DTOKBWBTYWCABR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NS.H2/c1-3-9-11(4-2)14-12-8-6-5-7-10(12)13-9;/h3-8,13H,1-2H2;1H.
What are the key properties of 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen?
2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen has a molecular weight of 203.31 g/mol, XLogP of 4.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-4H-1,4-benzothiazine;molecular hydrogen is sourced from PubChem (CID 142189141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).