About 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole
1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole (PubChem CID 142288647) has the molecular formula C27H25NS
and a molecular weight of 395.57 g/mol. Its IUPAC name is 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole.
Molecular Properties
| Compound Name | 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole |
| PubChem CID | 142288647 |
| Molecular Formula | C27H25NS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole |
| SMILES | C=Cc1c(/C=C\C(C)C)n(C2=CCC3C(=C2)Sc2ccccc23)c2ccccc12 |
| InChI | InChI=1S/C27H25NS/c1-4-20-21-9-5-7-11-24(21)28(25(20)16-13-18(2)3)19-14-15-23-22-10-6-8-12-26(22)29-27(23)17-19/h4-14,16-18,23H,1,15H2,2-3H3/b16-13- |
| InChIKey | JVDUFIYYTYOQMF-SSZFMOIBSA-N |
| XLogP | 7.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole?
The IUPAC name of 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole (CID 142288647) is 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole.
What is the SMILES notation for 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole?
The canonical SMILES for 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole is C=Cc1c(/C=C\C(C)C)n(C2=CCC3C(=C2)Sc2ccccc23)c2ccccc12.
What is the InChIKey of 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole?
The InChIKey is JVDUFIYYTYOQMF-SSZFMOIBSA-N. The full InChI is InChI=1S/C27H25NS/c1-4-20-21-9-5-7-11-24(21)28(25(20)16-13-18(2)3)19-14-15-23-22-10-6-8-12-26(22)29-27(23)17-19/h4-14,16-18,23H,1,15H2,2-3H3/b16-13-.
What are the key properties of 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole?
1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole has a molecular weight of 395.57 g/mol, XLogP of 7.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,9b-dihydrodibenzothiophen-3-yl)-3-ethenyl-2-[(Z)-3-methylbut-1-enyl]indole is sourced from PubChem (CID 142288647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).