C34H29N3Si — CID 90296239
2,4-diphenyl-6-(5,5,10,10-tetramethylindeno[1,2-b][1]benzosilol-6-yl)-1,3,5-triazine (PubChem CID 90296239) has the molecular formula C34H29N3Si and a molecular weight of 507.71 g/mol. Its IUPAC name is 2,4-diphenyl-6-(5,5,10,10-tetramethylindeno[1,2-b][1]benzosilol-6-yl)-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-(5,5,10,10-tetramethylindeno[1,2-b][1]benzosilol-6-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 90296239 |
| Molecular Formula | C34H29N3Si |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2,4-diphenyl-6-(5,5,10,10-tetramethylindeno[1,2-b][1]benzosilol-6-yl)-1,3,5-triazine |
| SMILES | CC1(C)C2=C(c3ccccc31)[Si](C)(C)c1c2cccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C34H29N3Si/c1-34(2)27-21-12-11-18-24(27)30-28(34)25-19-13-20-26(29(25)38(30,3)4)33-36-31(22-14-7-5-8-15-22)35-32(37-33)23-16-9-6-10-17-23/h5-21H,1-4H3 |
| InChIKey | IFFKDQHCDJIKFV-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|